C23H15F3N2OS — CID 2248748
(5Z)-3-phenyl-2-phenylimino-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 2248748) has the molecular formula C23H15F3N2OS and a molecular weight of 424.45 g/mol. Its IUPAC name is (5Z)-3-phenyl-2-phenylimino-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-phenyl-2-phenylimino-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 2248748 |
| Molecular Formula | C23H15F3N2OS |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (5Z)-3-phenyl-2-phenylimino-5-[[2-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccccc2C(F)(F)F)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C23H15F3N2OS/c24-23(25,26)19-14-8-7-9-16(19)15-20-21(29)28(18-12-5-2-6-13-18)22(30-20)27-17-10-3-1-4-11-17/h1-15H/b20-15-,27-22- |
| InChIKey | BCPOALWUMJLPKM-WVAYHADSSA-N |
| XLogP | 6.51 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|