C32H23N5O2S — CID 6259368
3-[(Z)-C-methyl-N-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]amino]carbonimidoyl]chromen-2-one (PubChem CID 6259368) has the molecular formula C32H23N5O2S and a molecular weight of 541.64 g/mol. Its IUPAC name is 3-[(Z)-C-methyl-N-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]amino]carbonimidoyl]chromen-2-one.
| Compound Name | 3-[(Z)-C-methyl-N-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]amino]carbonimidoyl]chromen-2-one |
|---|---|
| PubChem CID | 6259368 |
| Molecular Formula | C32H23N5O2S |
| Molecular Weight | 541.64 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 3-[(Z)-C-methyl-N-[(E)-[3-phenyl-4,5-bis(phenylimino)-1,3-thiazolidin-2-ylidene]amino]carbonimidoyl]chromen-2-one |
| SMILES | C/C(=N/N=C1/SC(=N\c2ccccc2)/C(=N\c2ccccc2)N1c1ccccc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C32H23N5O2S/c1-22(27-21-23-13-11-12-20-28(23)39-31(27)38)35-36-32-37(26-18-9-4-10-19-26)29(33-24-14-5-2-6-15-24)30(40-32)34-25-16-7-3-8-17-25/h2-21H,1H3/b33-29+,34-30-,35-22-,36-32+ |
| InChIKey | NYIYPUGUSQLJGS-TXDPIWRISA-N |
| XLogP | 7.59 |
| TPSA | 82.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.64 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|