About (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one
(4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one (PubChem CID 7157410) has the molecular formula C22H21N3O3
and a molecular weight of 375.43 g/mol. Its IUPAC name is (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one.
Molecular Properties
| Compound Name | (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one |
| PubChem CID | 7157410 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one |
| SMILES | C/C(=N\[C@@H]1C(=O)N(c2ccccc2)N(C)[C@H]1C)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C22H21N3O3/c1-14(18-13-16-9-7-8-12-19(16)28-22(18)27)23-20-15(2)24(3)25(21(20)26)17-10-5-4-6-11-17/h4-13,15,20H,1-3H3/b23-14+/t15-,20-/m0/s1 |
| InChIKey | DVJAATZFODMYRL-GCVGFEQUSA-N |
| XLogP | 3.25 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one?
The IUPAC name of (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one (CID 7157410) is (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one.
What is the SMILES notation for (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one?
The canonical SMILES for (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one is C/C(=N\[C@@H]1C(=O)N(c2ccccc2)N(C)[C@H]1C)c1cc2ccccc2oc1=O.
What is the InChIKey of (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one?
The InChIKey is DVJAATZFODMYRL-GCVGFEQUSA-N. The full InChI is InChI=1S/C22H21N3O3/c1-14(18-13-16-9-7-8-12-19(16)28-22(18)27)23-20-15(2)24(3)25(21(20)26)17-10-5-4-6-11-17/h4-13,15,20H,1-3H3/b23-14+/t15-,20-/m0/s1.
What are the key properties of (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one?
(4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one has a molecular weight of 375.43 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-1,5-dimethyl-4-[1-(2-oxochromen-3-yl)ethylideneamino]-2-phenylpyrazolidin-3-one is sourced from PubChem (CID 7157410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).