C28H22N4NiO2S2 — CID 135409864
bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) (PubChem CID 135409864) has the molecular formula C28H22N4NiO2S2 and a molecular weight of 569.34 g/mol. Its IUPAC name is bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+).
| Compound Name | bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) |
|---|---|
| PubChem CID | 135409864 |
| Molecular Formula | C28H22N4NiO2S2 |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) |
| SMILES | Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C14H12N2OS.Ni/c2*17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;/h2*1-10,17H,(H,16,18);/q;;+2/p-2/b2*15-10-; |
| InChIKey | HBPOZWATSWBYAJ-OIPUXKIXSA-L |
| XLogP | 5.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|