About bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+)
bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) (PubChem CID 135409864) has the molecular formula C28H22N4NiO2S2
and a molecular weight of 569.34 g/mol. Its IUPAC name is bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+).
Molecular Properties
| Compound Name | bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) |
| PubChem CID | 135409864 |
| Molecular Formula | C28H22N4NiO2S2 |
| Molecular Weight | 569.34 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) |
| SMILES | Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.[Ni+2] |
| InChI | InChI=1S/2C14H12N2OS.Ni/c2*17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;/h2*1-10,17H,(H,16,18);/q;;+2/p-2/b2*15-10-; |
| InChIKey | HBPOZWATSWBYAJ-OIPUXKIXSA-L |
| XLogP | 5.44 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 569.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+)?
The IUPAC name of bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) (CID 135409864) is bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+).
What is the SMILES notation for bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+)?
The canonical SMILES for bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) is Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.[Ni+2].
What is the InChIKey of bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+)?
The InChIKey is HBPOZWATSWBYAJ-OIPUXKIXSA-L. The full InChI is InChI=1S/2C14H12N2OS.Ni/c2*17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;/h2*1-10,17H,(H,16,18);/q;;+2/p-2/b2*15-10-;.
What are the key properties of bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+)?
bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) has a molecular weight of 569.34 g/mol, XLogP of 5.44, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis((NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate);nickel(2+) is sourced from PubChem (CID 135409864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).