C23H20N2O — CID 135751843
2-[(E)-(1,3-diphenylbut-2-enylidenehydrazinylidene)methyl]phenol (PubChem CID 135751843) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-[(E)-(1,3-diphenylbut-2-enylidenehydrazinylidene)methyl]phenol.
| Compound Name | 2-[(E)-(1,3-diphenylbut-2-enylidenehydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135751843 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 2-[(E)-(1,3-diphenylbut-2-enylidenehydrazinylidene)methyl]phenol |
| SMILES | CC(=CC(=N/N=C/c1ccccc1O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c1-18(19-10-4-2-5-11-19)16-22(20-12-6-3-7-13-20)25-24-17-21-14-8-9-15-23(21)26/h2-17,26H,1H3/b18-16?,24-17+,25-22? |
| InChIKey | KGFIXCIEGNPCNP-CRXHSFDGSA-N |
| XLogP | 5.32 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|