C17H19ClN4 — CID 135713874
diaminomethylidene-[(Z)-[(E)-1,3-diphenylbut-2-enylidene]amino]azanium chloride (PubChem CID 135713874) has the molecular formula C17H19ClN4 and a molecular weight of 314.82 g/mol. Its IUPAC name is diaminomethylidene-[(Z)-[(E)-1,3-diphenylbut-2-enylidene]amino]azanium chloride.
| Compound Name | diaminomethylidene-[(Z)-[(E)-1,3-diphenylbut-2-enylidene]amino]azanium chloride |
|---|---|
| PubChem CID | 135713874 |
| Molecular Formula | C17H19ClN4 |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | diaminomethylidene-[(Z)-[(E)-1,3-diphenylbut-2-enylidene]amino]azanium chloride |
| SMILES | C/C(=C\C(=N\[NH+]=C(N)N)c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C17H18N4.ClH/c1-13(14-8-4-2-5-9-14)12-16(20-21-17(18)19)15-10-6-3-7-11-15;/h2-12H,1H3,(H4,18,19,21);1H/b13-12+,20-16-; |
| InChIKey | FHQOLBQKSNLIEZ-NGUDBYGSSA-N |
| XLogP | -2.15 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|