C19H19N — CID 142986451
2-[(3Z,5E)-4-methyl-6-phenylhepta-1,3,5-trien-2-yl]pyridine (PubChem CID 142986451) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 2-[(3Z,5E)-4-methyl-6-phenylhepta-1,3,5-trien-2-yl]pyridine.
| Compound Name | 2-[(3Z,5E)-4-methyl-6-phenylhepta-1,3,5-trien-2-yl]pyridine |
|---|---|
| PubChem CID | 142986451 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 2-[(3Z,5E)-4-methyl-6-phenylhepta-1,3,5-trien-2-yl]pyridine |
| SMILES | C=C(/C=C(C)\C=C(/C)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C19H19N/c1-15(13-16(2)18-9-5-4-6-10-18)14-17(3)19-11-7-8-12-20-19/h4-14H,3H2,1-2H3/b15-14-,16-13+ |
| InChIKey | ABDKILHGYRSHKB-AILVWVMCSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|