C21H21N — CID 142200200
2-[(3E,5Z)-4-[(Z)-2-(2-methylphenyl)ethenyl]hepta-1,3,5-trien-2-yl]pyridine (PubChem CID 142200200) has the molecular formula C21H21N and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-[(3E,5Z)-4-[(Z)-2-(2-methylphenyl)ethenyl]hepta-1,3,5-trien-2-yl]pyridine.
| Compound Name | 2-[(3E,5Z)-4-[(Z)-2-(2-methylphenyl)ethenyl]hepta-1,3,5-trien-2-yl]pyridine |
|---|---|
| PubChem CID | 142200200 |
| Molecular Formula | C21H21N |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[(3E,5Z)-4-[(Z)-2-(2-methylphenyl)ethenyl]hepta-1,3,5-trien-2-yl]pyridine |
| SMILES | C=C(/C=C(\C=C/C)/C=C\c1ccccc1C)c1ccccn1 |
| InChI | InChI=1S/C21H21N/c1-4-9-19(13-14-20-11-6-5-10-17(20)2)16-18(3)21-12-7-8-15-22-21/h4-16H,3H2,1-2H3/b9-4-,14-13-,19-16+ |
| InChIKey | DISHYOWXPWGNSK-NHLHIMBXSA-N |
| XLogP | 5.62 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|