C21H20O2 — CID 11814409
(1E,4Z,6E)-5-hydroxy-1,7-bis(2-methylphenyl)hepta-1,4,6-trien-3-one (PubChem CID 11814409) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-1,7-bis(2-methylphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-1,7-bis(2-methylphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 11814409 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-1,7-bis(2-methylphenyl)hepta-1,4,6-trien-3-one |
| SMILES | Cc1ccccc1/C=C/C(=O)/C=C(O)/C=C/c1ccccc1C |
| InChI | InChI=1S/C21H20O2/c1-16-7-3-5-9-18(16)11-13-20(22)15-21(23)14-12-19-10-6-4-8-17(19)2/h3-15,22H,1-2H3/b13-11+,14-12+,20-15- |
| InChIKey | SGCJQPXIULQULC-XQWFHAJTSA-N |
| XLogP | 5.04 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|