About (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one
(1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one (PubChem CID 143010156) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one.
Molecular Properties
| Compound Name | (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one |
| PubChem CID | 143010156 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one |
| SMILES | C=CCC(=O)/C=C/c1ccccc1C |
| InChI | InChI=1S/C13H14O/c1-3-6-13(14)10-9-12-8-5-4-7-11(12)2/h3-5,7-10H,1,6H2,2H3/b10-9+ |
| InChIKey | AETROUDEEBVONQ-MDZDMXLPSA-N |
| XLogP | 3.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one?
The IUPAC name of (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one (CID 143010156) is (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one.
What is the SMILES notation for (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one?
The canonical SMILES for (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one is C=CCC(=O)/C=C/c1ccccc1C.
What is the InChIKey of (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one?
The InChIKey is AETROUDEEBVONQ-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H14O/c1-3-6-13(14)10-9-12-8-5-4-7-11(12)2/h3-5,7-10H,1,6H2,2H3/b10-9+.
What are the key properties of (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one?
(1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one has a molecular weight of 186.25 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-1-(2-methylphenyl)hexa-1,5-dien-3-one is sourced from PubChem (CID 143010156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).