C11H13N3O — CID 69438320
N-(diaminomethylidene)-3-(2-methylphenyl)prop-2-enamide (PubChem CID 69438320) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-(2-methylphenyl)prop-2-enamide.
| Compound Name | N-(diaminomethylidene)-3-(2-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 69438320 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | N-(diaminomethylidene)-3-(2-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccccc1C=CC(=O)N=C(N)N |
| InChI | InChI=1S/C11H13N3O/c1-8-4-2-3-5-9(8)6-7-10(15)14-11(12)13/h2-7H,1H3,(H4,12,13,14,15) |
| InChIKey | MMVUASXGHTWYSF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|