C12H15F3N6O — CID 174544050
N-(diaminomethylidene)-3-[2-(trifluoromethyl)phenyl]prop-2-enamide;guanidine (PubChem CID 174544050) has the molecular formula C12H15F3N6O and a molecular weight of 316.29 g/mol. Its IUPAC name is N-(diaminomethylidene)-3-[2-(trifluoromethyl)phenyl]prop-2-enamide;guanidine.
| Compound Name | N-(diaminomethylidene)-3-[2-(trifluoromethyl)phenyl]prop-2-enamide;guanidine |
|---|---|
| PubChem CID | 174544050 |
| Molecular Formula | C12H15F3N6O |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-(diaminomethylidene)-3-[2-(trifluoromethyl)phenyl]prop-2-enamide;guanidine |
| SMILES | NC(N)=NC(=O)C=Cc1ccccc1C(F)(F)F.[H]N=C(N)N |
| InChI | InChI=1S/C11H10F3N3O.CH5N3/c12-11(13,14)8-4-2-1-3-7(8)5-6-9(18)17-10(15)16;2-1(3)4/h1-6H,(H4,15,16,17,18);(H5,2,3,4) |
| InChIKey | BPMGNOIUIURJPH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 157.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|