C15H21N3O — CID 54529881
3-(2-methylphenyl)-N-[N'-(2-methylpropyl)carbamimidoyl]prop-2-enamide (PubChem CID 54529881) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(2-methylphenyl)-N-[N'-(2-methylpropyl)carbamimidoyl]prop-2-enamide.
| Compound Name | 3-(2-methylphenyl)-N-[N'-(2-methylpropyl)carbamimidoyl]prop-2-enamide |
|---|---|
| PubChem CID | 54529881 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-(2-methylphenyl)-N-[N'-(2-methylpropyl)carbamimidoyl]prop-2-enamide |
| SMILES | Cc1ccccc1C=CC(=O)N/C(N)=N/CC(C)C |
| InChI | InChI=1S/C15H21N3O/c1-11(2)10-17-15(16)18-14(19)9-8-13-7-5-4-6-12(13)3/h4-9,11H,10H2,1-3H3,(H3,16,17,18,19) |
| InChIKey | YVTBQUGQOOUOTA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|