C21H20O4 — CID 153275178
(1E,6E)-5-hydroxy-1,7-bis(2-methoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 153275178) has the molecular formula C21H20O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is (1E,6E)-5-hydroxy-1,7-bis(2-methoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,6E)-5-hydroxy-1,7-bis(2-methoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 153275178 |
| Molecular Formula | C21H20O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | (1E,6E)-5-hydroxy-1,7-bis(2-methoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1ccccc1/C=C/C(=O)C=C(O)/C=C/c1ccccc1OC |
| InChI | InChI=1S/C21H20O4/c1-24-20-9-5-3-7-16(20)11-13-18(22)15-19(23)14-12-17-8-4-6-10-21(17)25-2/h3-15,22H,1-2H3/b13-11+,14-12+,18-15? |
| InChIKey | UGDDIUYREDOFJT-NHGJSFOISA-N |
| XLogP | 4.44 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|