C28H22CoN4O2S2 — CID 135691300
cobalt(2+);(NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate;(Z)-N-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzenecarbohydrazonothioate (PubChem CID 135691300) has the molecular formula C28H22CoN4O2S2 and a molecular weight of 569.58 g/mol. Its IUPAC name is cobalt(2+);(NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate;(Z)-N-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzenecarbohydrazonothioate.
| Compound Name | cobalt(2+);(NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate;(Z)-N-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzenecarbohydrazonothioate |
|---|---|
| PubChem CID | 135691300 |
| Molecular Formula | C28H22CoN4O2S2 |
| Molecular Weight | 569.58 g/mol |
| Exact Mass | 569.05 |
| IUPAC Name | cobalt(2+);(NZ,Z)-N-[(2-hydroxyphenyl)methylidene]benzenecarbohydrazonothioate;(Z)-N-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]benzenecarbohydrazonothioate |
| SMILES | O=C1C=CC=C/C1=C/N/N=C(\[S-])c1ccccc1.Oc1ccccc1/C=N\N=C(/[S-])c1ccccc1.[Co+2] |
| InChI | InChI=1S/2C14H12N2OS.Co/c2*17-13-9-5-4-8-12(13)10-15-16-14(18)11-6-2-1-3-7-11;/h1-10,17H,(H,16,18);1-10,15H,(H,16,18);/q;;+2/p-2/b15-10-;12-10-; |
| InChIKey | SOLDXTCJGNFOPP-UAOBUEQESA-L |
| XLogP | 4.78 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|