C16H16N2O3 — CID 173276549
6-[[hydroxy-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methylidene]cyclohexa-2,4-dien-1-one (PubChem CID 173276549) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-[[hydroxy-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | 6-[[hydroxy-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 173276549 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-[[hydroxy-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methylidene]cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1=CN(O)CC/N=C/c1ccccc1O |
| InChI | InChI=1S/C16H16N2O3/c19-15-7-3-1-5-13(15)11-17-9-10-18(21)12-14-6-2-4-8-16(14)20/h1-8,11-12,19,21H,9-10H2/b14-12?,17-11+ |
| InChIKey | ZDICEHOWJHIXLI-OEVDRRDCSA-N |
| XLogP | 2.08 |
| TPSA | 73.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|