C23H24N2O3 — CID 136504665
2-[[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]phenol (PubChem CID 136504665) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]phenol.
| Compound Name | 2-[[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 136504665 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[[(2-hydroxyphenyl)methyl-[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]phenol |
| SMILES | Oc1ccccc1/C=N/CCN(Cc1ccccc1O)Cc1ccccc1O |
| InChI | InChI=1S/C23H24N2O3/c26-21-10-4-1-7-18(21)15-24-13-14-25(16-19-8-2-5-11-22(19)27)17-20-9-3-6-12-23(20)28/h1-12,15,26-28H,13-14,16-17H2/b24-15+ |
| InChIKey | YVGNEZFFZZOXFL-BUVRLJJBSA-N |
| XLogP | 3.92 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|