C25H28N4O4 — CID 163170854
4-[[bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 163170854) has the molecular formula C25H28N4O4 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[[bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163170854 |
| Molecular Formula | C25H28N4O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 4-[[bis[2-[(2-hydroxyphenyl)methylideneamino]ethyl]amino]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | [O-][NH+](O)c1ccc(CN(CC/N=C/c2ccccc2O)CC/N=C/c2ccccc2O)cc1 |
| InChI | InChI=1S/C25H28N4O4/c30-24-7-3-1-5-21(24)17-26-13-15-28(19-20-9-11-23(12-10-20)29(32)33)16-14-27-18-22-6-2-4-8-25(22)31/h1-12,17-18,29-32H,13-16,19H2/b26-17+,27-18+ |
| InChIKey | VIDUCGJCIPSWKZ-HEPXYTLMSA-N |
| XLogP | 2.54 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|