C24H20N4NiO3S — CID 135591817
(1E)-1-[(2-hydroxyphenyl)methylidene]-3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;nickel;quinolin-8-ol (PubChem CID 135591817) has the molecular formula C24H20N4NiO3S and a molecular weight of 503.21 g/mol. Its IUPAC name is (1E)-1-[(2-hydroxyphenyl)methylidene]-3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;nickel;quinolin-8-ol.
| Compound Name | (1E)-1-[(2-hydroxyphenyl)methylidene]-3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;nickel;quinolin-8-ol |
|---|---|
| PubChem CID | 135591817 |
| Molecular Formula | C24H20N4NiO3S |
| Molecular Weight | 503.21 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | (1E)-1-[(2-hydroxyphenyl)methylidene]-3-[[(E)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;nickel;quinolin-8-ol |
| SMILES | O=C1C=CC=C/C1=C\NNC(=S)/N=C/c1ccccc1O.Oc1cccc2cccnc12.[Ni] |
| InChI | InChI=1S/C15H13N3O2S.C9H7NO.Ni/c19-13-7-3-1-5-11(13)9-16-15(21)18-17-10-12-6-2-4-8-14(12)20;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-10,17,19H,(H,18,21);1-6,11H;/b12-10+,16-9+;; |
| InChIKey | YTPPYXYHBWFXJG-HTVCYOFBSA-N |
| XLogP | 3.71 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|