C24H20FeN4O3S — CID 11237309
iron;1-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;quinolin-8-ol (PubChem CID 11237309) has the molecular formula C24H20FeN4O3S and a molecular weight of 500.36 g/mol. Its IUPAC name is iron;1-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;quinolin-8-ol.
| Compound Name | iron;1-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;quinolin-8-ol |
|---|---|
| PubChem CID | 11237309 |
| Molecular Formula | C24H20FeN4O3S |
| Molecular Weight | 500.36 g/mol |
| Exact Mass | 500.06 |
| IUPAC Name | iron;1-[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]-3-[[(Z)-(6-oxocyclohexa-2,4-dien-1-ylidene)methyl]amino]thiourea;quinolin-8-ol |
| SMILES | O=C1C=CC=C/C1=C/NNC(=S)N/C=C1/C=CC=CC1=O.Oc1cccc2cccnc12.[Fe] |
| InChI | InChI=1S/C15H13N3O2S.C9H7NO.Fe/c19-13-7-3-1-5-11(13)9-16-15(21)18-17-10-12-6-2-4-8-14(12)20;11-8-5-1-3-7-4-2-6-10-9(7)8;/h1-10,17H,(H2,16,18,21);1-6,11H;/b11-9-,12-10-;; |
| InChIKey | JTAADDBTUOVOPU-OPIPZQGHSA-N |
| XLogP | 3.05 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|