C16H15N7S — CID 59950014
5-N-[(Z)-(4-isocyano-1,2-dimethylpyrazol-3-ylidene)amino]-2-N-methyl-4-phenyl-1,3-thiazole-2,5-diimine (PubChem CID 59950014) has the molecular formula C16H15N7S and a molecular weight of 337.41 g/mol. Its IUPAC name is 5-N-[(Z)-(4-isocyano-1,2-dimethylpyrazol-3-ylidene)amino]-2-N-methyl-4-phenyl-1,3-thiazole-2,5-diimine.
| Compound Name | 5-N-[(Z)-(4-isocyano-1,2-dimethylpyrazol-3-ylidene)amino]-2-N-methyl-4-phenyl-1,3-thiazole-2,5-diimine |
|---|---|
| PubChem CID | 59950014 |
| Molecular Formula | C16H15N7S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 5-N-[(Z)-(4-isocyano-1,2-dimethylpyrazol-3-ylidene)amino]-2-N-methyl-4-phenyl-1,3-thiazole-2,5-diimine |
| SMILES | [C-]#[N+]c1cn(C)n(C)/c1=N\N=C1/S/C(=N\C)N=C1c1ccccc1 |
| InChI | InChI=1S/C16H15N7S/c1-17-12-10-22(3)23(4)14(12)20-21-15-13(19-16(18-2)24-15)11-8-6-5-7-9-11/h5-10H,2-4H3/b18-16-,20-14-,21-15- |
| InChIKey | UGTGNXNJPADTEN-XOVVHXKQSA-N |
| XLogP | 2.35 |
| TPSA | 63.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_imine_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|