C6H7N3 — CID 20736941
4-isocyano-1,3-dimethylpyrazole (PubChem CID 20736941) has the molecular formula C6H7N3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 4-isocyano-1,3-dimethylpyrazole.
| Compound Name | 4-isocyano-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 20736941 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 4-isocyano-1,3-dimethylpyrazole |
| SMILES | [C-]#[N+]c1cn(C)nc1C |
| InChI | InChI=1S/C6H7N3/c1-5-6(7-2)4-9(3)8-5/h4H,1,3H3 |
| InChIKey | GKYXSYXKMPECSO-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|