C10H14N6 — CID 162540280
bis(1,4-dimethylpyrazol-3-yl)diazene (PubChem CID 162540280) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is bis(1,4-dimethylpyrazol-3-yl)diazene.
| Compound Name | bis(1,4-dimethylpyrazol-3-yl)diazene |
|---|---|
| PubChem CID | 162540280 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | bis(1,4-dimethylpyrazol-3-yl)diazene |
| SMILES | Cc1cn(C)nc1/N=N/c1nn(C)cc1C |
| InChI | InChI=1S/C10H14N6/c1-7-5-15(3)13-9(7)11-12-10-8(2)6-16(4)14-10/h5-6H,1-4H3/b12-11+ |
| InChIKey | DSTMGISZJXGKGU-VAWYXSNFSA-N |
| XLogP | 2.19 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|