About 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole
1,4-dimethylpyrazole;1,3,4-trimethylpyrazole (PubChem CID 162077924) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole.
Molecular Properties
| Compound Name | 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole |
| PubChem CID | 162077924 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole |
| SMILES | Cc1cn(C)nc1C.Cc1cnn(C)c1 |
| InChI | InChI=1S/C6H10N2.C5H8N2/c1-5-4-8(3)7-6(5)2;1-5-3-6-7(2)4-5/h4H,1-3H3;3-4H,1-2H3 |
| InChIKey | ZBYIRNNFWNJBRM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole?
The IUPAC name of 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole (CID 162077924) is 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole.
What is the SMILES notation for 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole?
The canonical SMILES for 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole is Cc1cn(C)nc1C.Cc1cnn(C)c1.
What is the InChIKey of 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole?
The InChIKey is ZBYIRNNFWNJBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.C5H8N2/c1-5-4-8(3)7-6(5)2;1-5-3-6-7(2)4-5/h4H,1-3H3;3-4H,1-2H3.
What are the key properties of 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole?
1,4-dimethylpyrazole;1,3,4-trimethylpyrazole has a molecular weight of 206.29 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylpyrazole;1,3,4-trimethylpyrazole is sourced from PubChem (CID 162077924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).