About 1,3-dimethylpyrazole;1,4-dimethylpyrazole
1,3-dimethylpyrazole;1,4-dimethylpyrazole (PubChem CID 160655475) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is 1,3-dimethylpyrazole;1,4-dimethylpyrazole.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazole;1,4-dimethylpyrazole |
| PubChem CID | 160655475 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | 1,3-dimethylpyrazole;1,4-dimethylpyrazole |
| SMILES | Cc1ccn(C)n1.Cc1cnn(C)c1 |
| InChI | InChI=1S/2C5H8N2/c1-5-3-6-7(2)4-5;1-5-3-4-7(2)6-5/h2*3-4H,1-2H3 |
| InChIKey | RKZGMFUDGQBKEY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-dimethylpyrazole;1,4-dimethylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazole;1,4-dimethylpyrazole?
The IUPAC name of 1,3-dimethylpyrazole;1,4-dimethylpyrazole (CID 160655475) is 1,3-dimethylpyrazole;1,4-dimethylpyrazole.
What is the SMILES notation for 1,3-dimethylpyrazole;1,4-dimethylpyrazole?
The canonical SMILES for 1,3-dimethylpyrazole;1,4-dimethylpyrazole is Cc1ccn(C)n1.Cc1cnn(C)c1.
What is the InChIKey of 1,3-dimethylpyrazole;1,4-dimethylpyrazole?
The InChIKey is RKZGMFUDGQBKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8N2/c1-5-3-6-7(2)4-5;1-5-3-4-7(2)6-5/h2*3-4H,1-2H3.
What are the key properties of 1,3-dimethylpyrazole;1,4-dimethylpyrazole?
1,3-dimethylpyrazole;1,4-dimethylpyrazole has a molecular weight of 192.27 g/mol, XLogP of 1.46, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazole;1,4-dimethylpyrazole is sourced from PubChem (CID 160655475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).