About 1,3-dimethylpyrazole;1-iodopropane
1,3-dimethylpyrazole;1-iodopropane (PubChem CID 143211289) has the molecular formula C8H15IN2
and a molecular weight of 266.13 g/mol. Its IUPAC name is 1,3-dimethylpyrazole;1-iodopropane.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazole;1-iodopropane |
| PubChem CID | 143211289 |
| Molecular Formula | C8H15IN2 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1,3-dimethylpyrazole;1-iodopropane |
| SMILES | CCCI.Cc1ccn(C)n1 |
| InChI | InChI=1S/C5H8N2.C3H7I/c1-5-3-4-7(2)6-5;1-2-3-4/h3-4H,1-2H3;2-3H2,1H3 |
| InChIKey | ADNBHTCFBMCUHM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethylpyrazole;1-iodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazole;1-iodopropane?
The IUPAC name of 1,3-dimethylpyrazole;1-iodopropane (CID 143211289) is 1,3-dimethylpyrazole;1-iodopropane.
What is the SMILES notation for 1,3-dimethylpyrazole;1-iodopropane?
The canonical SMILES for 1,3-dimethylpyrazole;1-iodopropane is CCCI.Cc1ccn(C)n1.
What is the InChIKey of 1,3-dimethylpyrazole;1-iodopropane?
The InChIKey is ADNBHTCFBMCUHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C3H7I/c1-5-3-4-7(2)6-5;1-2-3-4/h3-4H,1-2H3;2-3H2,1H3.
What are the key properties of 1,3-dimethylpyrazole;1-iodopropane?
1,3-dimethylpyrazole;1-iodopropane has a molecular weight of 266.13 g/mol, XLogP of 2.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazole;1-iodopropane is sourced from PubChem (CID 143211289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).