About 1,3-dimethylpyrazole;ethane;2-methylfuran
1,3-dimethylpyrazole;ethane;2-methylfuran (PubChem CID 142324709) has the molecular formula C14H26N2O
and a molecular weight of 238.37 g/mol. Its IUPAC name is 1,3-dimethylpyrazole;ethane;2-methylfuran.
Molecular Properties
| Compound Name | 1,3-dimethylpyrazole;ethane;2-methylfuran |
| PubChem CID | 142324709 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1,3-dimethylpyrazole;ethane;2-methylfuran |
| SMILES | CC.CC.Cc1ccco1.Cc1ccn(C)n1 |
| InChI | InChI=1S/C5H8N2.C5H6O.2C2H6/c1-5-3-4-7(2)6-5;1-5-3-2-4-6-5;2*1-2/h3-4H,1-2H3;2-4H,1H3;2*1-2H3 |
| InChIKey | GONNTMBNRPTTFW-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethylpyrazole;ethane;2-methylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylpyrazole;ethane;2-methylfuran?
The IUPAC name of 1,3-dimethylpyrazole;ethane;2-methylfuran (CID 142324709) is 1,3-dimethylpyrazole;ethane;2-methylfuran.
What is the SMILES notation for 1,3-dimethylpyrazole;ethane;2-methylfuran?
The canonical SMILES for 1,3-dimethylpyrazole;ethane;2-methylfuran is CC.CC.Cc1ccco1.Cc1ccn(C)n1.
What is the InChIKey of 1,3-dimethylpyrazole;ethane;2-methylfuran?
The InChIKey is GONNTMBNRPTTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2.C5H6O.2C2H6/c1-5-3-4-7(2)6-5;1-5-3-2-4-6-5;2*1-2/h3-4H,1-2H3;2-4H,1H3;2*1-2H3.
What are the key properties of 1,3-dimethylpyrazole;ethane;2-methylfuran?
1,3-dimethylpyrazole;ethane;2-methylfuran has a molecular weight of 238.37 g/mol, XLogP of 4.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazole;ethane;2-methylfuran is sourced from PubChem (CID 142324709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).