C5H7N4+ — CID 12687201
1,3-dimethylpyrazole-4-diazonium (PubChem CID 12687201) has the molecular formula C5H7N4+ and a molecular weight of 123.14 g/mol. Its IUPAC name is 1,3-dimethylpyrazole-4-diazonium.
| Compound Name | 1,3-dimethylpyrazole-4-diazonium |
|---|---|
| PubChem CID | 12687201 |
| Molecular Formula | C5H7N4+ |
| Molecular Weight | 123.14 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1,3-dimethylpyrazole-4-diazonium |
| SMILES | Cc1nn(C)cc1[N+]#N |
| InChI | InChI=1S/C5H7N4/c1-4-5(7-6)3-9(2)8-4/h3H,1-2H3/q+1 |
| InChIKey | LJWIBVWKAZYGDH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.14 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|