C9H11N5 — CID 112559104
3-(1,3-dimethylpyrazol-4-yl)pyrazin-2-amine (PubChem CID 112559104) has the molecular formula C9H11N5 and a molecular weight of 189.22 g/mol. Its IUPAC name is 3-(1,3-dimethylpyrazol-4-yl)pyrazin-2-amine.
| Compound Name | 3-(1,3-dimethylpyrazol-4-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 112559104 |
| Molecular Formula | C9H11N5 |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 3-(1,3-dimethylpyrazol-4-yl)pyrazin-2-amine |
| SMILES | Cc1nn(C)cc1-c1nccnc1N |
| InChI | InChI=1S/C9H11N5/c1-6-7(5-14(2)13-6)8-9(10)12-4-3-11-8/h3-5H,1-2H3,(H2,10,12) |
| InChIKey | RHVQPLFUKFNENH-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |