C6H10N2OS — CID 142372649
1,3-dimethyl-4-methylsulfinylpyrazole (PubChem CID 142372649) has the molecular formula C6H10N2OS and a molecular weight of 158.23 g/mol. Its IUPAC name is 1,3-dimethyl-4-methylsulfinylpyrazole.
| Compound Name | 1,3-dimethyl-4-methylsulfinylpyrazole |
|---|---|
| PubChem CID | 142372649 |
| Molecular Formula | C6H10N2OS |
| Molecular Weight | 158.23 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1,3-dimethyl-4-methylsulfinylpyrazole |
| SMILES | Cc1nn(C)cc1S(C)=O |
| InChI | InChI=1S/C6H10N2OS/c1-5-6(10(3)9)4-8(2)7-5/h4H,1-3H3 |
| InChIKey | WIHQHZRAZXSRJR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |