C13H15ClN4O2 — CID 19588271
2-chloro-1,3-bis(1,3-dimethylpyrazol-4-yl)propane-1,3-dione (PubChem CID 19588271) has the molecular formula C13H15ClN4O2 and a molecular weight of 294.74 g/mol. Its IUPAC name is 2-chloro-1,3-bis(1,3-dimethylpyrazol-4-yl)propane-1,3-dione.
| Compound Name | 2-chloro-1,3-bis(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 19588271 |
| Molecular Formula | C13H15ClN4O2 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-chloro-1,3-bis(1,3-dimethylpyrazol-4-yl)propane-1,3-dione |
| SMILES | Cc1nn(C)cc1C(=O)C(Cl)C(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C13H15ClN4O2/c1-7-9(5-17(3)15-7)12(19)11(14)13(20)10-6-18(4)16-8(10)2/h5-6,11H,1-4H3 |
| InChIKey | WEMAZESPUFUTDS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|