1,3-dimethylpyrazole-4-carboxylic acid;ethane

C8H14N2O2 — CID 142969611

IUPAC1,3-dimethylpyrazole-4-carboxylic acid;ethane
SMILESCC.Cc1nn(C)cc1C(=O)O
InChIInChI=1S/C6H8N2O2.C2H6/c1-4-5(6(9)10)3-8(2)7-4;1-2/h3H,1-2H3,(H,9,10);1-2H3
InChIKeyGKEGNXRUHZJFGQ-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.45
Rot. Bonds1

About 1,3-dimethylpyrazole-4-carboxylic acid;ethane

1,3-dimethylpyrazole-4-carboxylic acid;ethane (PubChem CID 142969611) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,3-dimethylpyrazole-4-carboxylic acid;ethane.

Molecular Properties

Compound Name1,3-dimethylpyrazole-4-carboxylic acid;ethane
PubChem CID142969611
Molecular FormulaC8H14N2O2
Molecular Weight170.21 g/mol
Exact Mass170.11
IUPAC Name1,3-dimethylpyrazole-4-carboxylic acid;ethane
SMILESCC.Cc1nn(C)cc1C(=O)O
InChIInChI=1S/C6H8N2O2.C2H6/c1-4-5(6(9)10)3-8(2)7-4;1-2/h3H,1-2H3,(H,9,10);1-2H3
InChIKeyGKEGNXRUHZJFGQ-UHFFFAOYSA-N
XLogP1.45
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,3-dimethylpyrazole-4-carboxylic acid;ethane with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-dimethylpyrazole-4-carboxylic acid;ethane?
The IUPAC name of 1,3-dimethylpyrazole-4-carboxylic acid;ethane (CID 142969611) is 1,3-dimethylpyrazole-4-carboxylic acid;ethane.
What is the SMILES notation for 1,3-dimethylpyrazole-4-carboxylic acid;ethane?
The canonical SMILES for 1,3-dimethylpyrazole-4-carboxylic acid;ethane is CC.Cc1nn(C)cc1C(=O)O.
What is the InChIKey of 1,3-dimethylpyrazole-4-carboxylic acid;ethane?
The InChIKey is GKEGNXRUHZJFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.C2H6/c1-4-5(6(9)10)3-8(2)7-4;1-2/h3H,1-2H3,(H,9,10);1-2H3.
What are the key properties of 1,3-dimethylpyrazole-4-carboxylic acid;ethane?
1,3-dimethylpyrazole-4-carboxylic acid;ethane has a molecular weight of 170.21 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylpyrazole-4-carboxylic acid;ethane is sourced from PubChem (CID 142969611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).