C8H14N2O2 — CID 142969611
1,3-dimethylpyrazole-4-carboxylic acid;ethane (PubChem CID 142969611) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 1,3-dimethylpyrazole-4-carboxylic acid;ethane.
| Compound Name | 1,3-dimethylpyrazole-4-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142969611 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 1,3-dimethylpyrazole-4-carboxylic acid;ethane |
| SMILES | CC.Cc1nn(C)cc1C(=O)O |
| InChI | InChI=1S/C6H8N2O2.C2H6/c1-4-5(6(9)10)3-8(2)7-4;1-2/h3H,1-2H3,(H,9,10);1-2H3 |
| InChIKey | GKEGNXRUHZJFGQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |