C10H14N2O — CID 102802822
1-(1,3-dimethylpyrazol-4-yl)-3-methylbut-2-en-1-one (PubChem CID 102802822) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)-3-methylbut-2-en-1-one.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)-3-methylbut-2-en-1-one |
|---|---|
| PubChem CID | 102802822 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)-3-methylbut-2-en-1-one |
| SMILES | CC(C)=CC(=O)c1cn(C)nc1C |
| InChI | InChI=1S/C10H14N2O/c1-7(2)5-10(13)9-6-12(4)11-8(9)3/h5-6H,1-4H3 |
| InChIKey | AVHGJZYCPXBOES-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|