C15H16N2O2 — CID 19556586
(2E,4E)-1-(1,3-dimethylpyrazol-4-yl)-5-(furan-2-yl)-4-methylpenta-2,4-dien-1-one (PubChem CID 19556586) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is (2E,4E)-1-(1,3-dimethylpyrazol-4-yl)-5-(furan-2-yl)-4-methylpenta-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-(1,3-dimethylpyrazol-4-yl)-5-(furan-2-yl)-4-methylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 19556586 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | (2E,4E)-1-(1,3-dimethylpyrazol-4-yl)-5-(furan-2-yl)-4-methylpenta-2,4-dien-1-one |
| SMILES | CC(/C=C/C(=O)c1cn(C)nc1C)=C\c1ccco1 |
| InChI | InChI=1S/C15H16N2O2/c1-11(9-13-5-4-8-19-13)6-7-15(18)14-10-17(3)16-12(14)2/h4-10H,1-3H3/b7-6+,11-9+ |
| InChIKey | PQTWKEZTBUADBY-RXUIJTJXSA-N |
| XLogP | 3.16 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|