C10H10N4O — CID 6878580
(E,E)-3-(furan-2-yl)-2-methyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine (PubChem CID 6878580) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is (E,E)-3-(furan-2-yl)-2-methyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine.
| Compound Name | (E,E)-3-(furan-2-yl)-2-methyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 6878580 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | (E,E)-3-(furan-2-yl)-2-methyl-N-(1,2,4-triazol-4-yl)prop-2-en-1-imine |
| SMILES | CC(/C=N/n1cnnc1)=C\c1ccco1 |
| InChI | InChI=1S/C10H10N4O/c1-9(5-10-3-2-4-15-10)6-13-14-7-11-12-8-14/h2-8H,1H3/b9-5+,13-6+ |
| InChIKey | URTKAHOGXVJFOY-PMHYKQBESA-N |
| XLogP | 1.81 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|