C15H14N2O — CID 54606331
(E,Z)-N-[(E)-furan-2-ylmethylideneamino]-2-methyl-3-phenylprop-2-en-1-imine (PubChem CID 54606331) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is (E,Z)-N-[(E)-furan-2-ylmethylideneamino]-2-methyl-3-phenylprop-2-en-1-imine.
| Compound Name | (E,Z)-N-[(E)-furan-2-ylmethylideneamino]-2-methyl-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 54606331 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (E,Z)-N-[(E)-furan-2-ylmethylideneamino]-2-methyl-3-phenylprop-2-en-1-imine |
| SMILES | CC(=C/c1ccccc1)/C=N/N=C/c1ccco1 |
| InChI | InChI=1S/C15H14N2O/c1-13(10-14-6-3-2-4-7-14)11-16-17-12-15-8-5-9-18-15/h2-12H,1H3/b13-10-,16-11+,17-12+ |
| InChIKey | ZIDYHMWVTDAEMM-RPNUOTCHSA-N |
| XLogP | 3.79 |
| TPSA | 37.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|