C13H24N4 — CID 170573695
ethane;4-ethyl-1,3-dimethylpyrazole;1-methylpyrazole (PubChem CID 170573695) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is ethane;4-ethyl-1,3-dimethylpyrazole;1-methylpyrazole.
| Compound Name | ethane;4-ethyl-1,3-dimethylpyrazole;1-methylpyrazole |
|---|---|
| PubChem CID | 170573695 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | ethane;4-ethyl-1,3-dimethylpyrazole;1-methylpyrazole |
| SMILES | CC.CCc1cn(C)nc1C.Cn1cccn1 |
| InChI | InChI=1S/C7H12N2.C4H6N2.C2H6/c1-4-7-5-9(3)8-6(7)2;1-6-4-2-3-5-6;1-2/h5H,4H2,1-3H3;2-4H,1H3;1-2H3 |
| InChIKey | XSRXYYBSSNFLJT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |