C9H15BrN2 — CID 127002490
4-(3-bromo-2-methylpropyl)-1,3-dimethylpyrazole (PubChem CID 127002490) has the molecular formula C9H15BrN2 and a molecular weight of 231.14 g/mol. Its IUPAC name is 4-(3-bromo-2-methylpropyl)-1,3-dimethylpyrazole.
| Compound Name | 4-(3-bromo-2-methylpropyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 127002490 |
| Molecular Formula | C9H15BrN2 |
| Molecular Weight | 231.14 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 4-(3-bromo-2-methylpropyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1CC(C)CBr |
| InChI | InChI=1S/C9H15BrN2/c1-7(5-10)4-9-6-12(3)11-8(9)2/h6-7H,4-5H2,1-3H3 |
| InChIKey | WORXMBJBLJRLEV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.14 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|