C10H20N2O — CID 169138415
ethane;2-(4-ethyl-3-methylpyrazol-1-yl)ethanol (PubChem CID 169138415) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is ethane;2-(4-ethyl-3-methylpyrazol-1-yl)ethanol.
| Compound Name | ethane;2-(4-ethyl-3-methylpyrazol-1-yl)ethanol |
|---|---|
| PubChem CID | 169138415 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;2-(4-ethyl-3-methylpyrazol-1-yl)ethanol |
| SMILES | CC.CCc1cn(CCO)nc1C |
| InChI | InChI=1S/C8H14N2O.C2H6/c1-3-8-6-10(4-5-11)9-7(8)2;1-2/h6,11H,3-5H2,1-2H3;1-2H3 |
| InChIKey | QKEIQWKRLZAMQI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |