C7H11N3O2 — CID 166160342
N-[1-(2-hydroxyethyl)-3-methylpyrazol-4-yl]formamide (PubChem CID 166160342) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is N-[1-(2-hydroxyethyl)-3-methylpyrazol-4-yl]formamide.
| Compound Name | N-[1-(2-hydroxyethyl)-3-methylpyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 166160342 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-[1-(2-hydroxyethyl)-3-methylpyrazol-4-yl]formamide |
| SMILES | Cc1nn(CCO)cc1NC=O |
| InChI | InChI=1S/C7H11N3O2/c1-6-7(8-5-12)4-10(9-6)2-3-11/h4-5,11H,2-3H2,1H3,(H,8,12) |
| InChIKey | UXQXXGNZTHETFS-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|