About methane;2-methylindazole;1-methylpyrazole
methane;2-methylindazole;1-methylpyrazole (PubChem CID 160697576) has the molecular formula C13H18N4
and a molecular weight of 230.31 g/mol. Its IUPAC name is methane;2-methylindazole;1-methylpyrazole.
Molecular Properties
| Compound Name | methane;2-methylindazole;1-methylpyrazole |
| PubChem CID | 160697576 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | methane;2-methylindazole;1-methylpyrazole |
| SMILES | C.Cn1cc2ccccc2n1.Cn1cccn1 |
| InChI | InChI=1S/C8H8N2.C4H6N2.CH4/c1-10-6-7-4-2-3-5-8(7)9-10;1-6-4-2-3-5-6;/h2-6H,1H3;2-4H,1H3;1H4 |
| InChIKey | RQEQTKHLHABEAC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methane;2-methylindazole;1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylindazole;1-methylpyrazole?
The IUPAC name of methane;2-methylindazole;1-methylpyrazole (CID 160697576) is methane;2-methylindazole;1-methylpyrazole.
What is the SMILES notation for methane;2-methylindazole;1-methylpyrazole?
The canonical SMILES for methane;2-methylindazole;1-methylpyrazole is C.Cn1cc2ccccc2n1.Cn1cccn1.
What is the InChIKey of methane;2-methylindazole;1-methylpyrazole?
The InChIKey is RQEQTKHLHABEAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2.C4H6N2.CH4/c1-10-6-7-4-2-3-5-8(7)9-10;1-6-4-2-3-5-6;/h2-6H,1H3;2-4H,1H3;1H4.
What are the key properties of methane;2-methylindazole;1-methylpyrazole?
methane;2-methylindazole;1-methylpyrazole has a molecular weight of 230.31 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylindazole;1-methylpyrazole is sourced from PubChem (CID 160697576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).