About ethane;2-methylpropane;2-propan-2-ylindazole
ethane;2-methylpropane;2-propan-2-ylindazole (PubChem CID 159582971) has the molecular formula C16H28N2
and a molecular weight of 248.41 g/mol. Its IUPAC name is ethane;2-methylpropane;2-propan-2-ylindazole.
Molecular Properties
| Compound Name | ethane;2-methylpropane;2-propan-2-ylindazole |
| PubChem CID | 159582971 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | ethane;2-methylpropane;2-propan-2-ylindazole |
| SMILES | CC.CC(C)C.CC(C)n1cc2ccccc2n1 |
| InChI | InChI=1S/C10H12N2.C4H10.C2H6/c1-8(2)12-7-9-5-3-4-6-10(9)11-12;1-4(2)3;1-2/h3-8H,1-2H3;4H,1-3H3;1-2H3 |
| InChIKey | MJGDQUPPRVADNK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-methylpropane;2-propan-2-ylindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylpropane;2-propan-2-ylindazole?
The IUPAC name of ethane;2-methylpropane;2-propan-2-ylindazole (CID 159582971) is ethane;2-methylpropane;2-propan-2-ylindazole.
What is the SMILES notation for ethane;2-methylpropane;2-propan-2-ylindazole?
The canonical SMILES for ethane;2-methylpropane;2-propan-2-ylindazole is CC.CC(C)C.CC(C)n1cc2ccccc2n1.
What is the InChIKey of ethane;2-methylpropane;2-propan-2-ylindazole?
The InChIKey is MJGDQUPPRVADNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2.C4H10.C2H6/c1-8(2)12-7-9-5-3-4-6-10(9)11-12;1-4(2)3;1-2/h3-8H,1-2H3;4H,1-3H3;1-2H3.
What are the key properties of ethane;2-methylpropane;2-propan-2-ylindazole?
ethane;2-methylpropane;2-propan-2-ylindazole has a molecular weight of 248.41 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylpropane;2-propan-2-ylindazole is sourced from PubChem (CID 159582971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).