C9H8Br2N2 — CID 1271665
2-[(1S)-1,2-dibromoethyl]indazole (PubChem CID 1271665) has the molecular formula C9H8Br2N2 and a molecular weight of 303.99 g/mol. Its IUPAC name is 2-[(1S)-1,2-dibromoethyl]indazole.
| Compound Name | 2-[(1S)-1,2-dibromoethyl]indazole |
|---|---|
| PubChem CID | 1271665 |
| Molecular Formula | C9H8Br2N2 |
| Molecular Weight | 303.99 g/mol |
| Exact Mass | 301.91 |
| IUPAC Name | 2-[(1S)-1,2-dibromoethyl]indazole |
| SMILES | BrC[C@H](Br)n1cc2ccccc2n1 |
| InChI | InChI=1S/C9H8Br2N2/c10-5-9(11)13-6-7-3-1-2-4-8(7)12-13/h1-4,6,9H,5H2/t9-/m1/s1 |
| InChIKey | ODKDISPKDSDRJC-SECBINFHSA-N |
| XLogP | 3.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.99 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|