C12H11Br3N2O — CID 12530744
2-[[(E)-2-bromoethenoxy]methyl]-1-(1,2-dibromoethyl)benzimidazole (PubChem CID 12530744) has the molecular formula C12H11Br3N2O and a molecular weight of 438.95 g/mol. Its IUPAC name is 2-[[(E)-2-bromoethenoxy]methyl]-1-(1,2-dibromoethyl)benzimidazole.
| Compound Name | 2-[[(E)-2-bromoethenoxy]methyl]-1-(1,2-dibromoethyl)benzimidazole |
|---|---|
| PubChem CID | 12530744 |
| Molecular Formula | C12H11Br3N2O |
| Molecular Weight | 438.95 g/mol |
| Exact Mass | 435.84 |
| IUPAC Name | 2-[[(E)-2-bromoethenoxy]methyl]-1-(1,2-dibromoethyl)benzimidazole |
| SMILES | Br/C=C/OCc1nc2ccccc2n1C(Br)CBr |
| InChI | InChI=1S/C12H11Br3N2O/c13-5-6-18-8-12-16-9-3-1-2-4-10(9)17(12)11(15)7-14/h1-6,11H,7-8H2/b6-5+ |
| InChIKey | LIEGSOPKTWESQW-AATRIKPKSA-N |
| XLogP | 4.71 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.95 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|