C12H15N3 — CID 12982249
N,1,2-trimethyl-5-phenylpyrazol-3-imine (PubChem CID 12982249) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is N,1,2-trimethyl-5-phenylpyrazol-3-imine.
| Compound Name | N,1,2-trimethyl-5-phenylpyrazol-3-imine |
|---|---|
| PubChem CID | 12982249 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | N,1,2-trimethyl-5-phenylpyrazol-3-imine |
| SMILES | C/N=c1\cc(-c2ccccc2)n(C)n1C |
| InChI | InChI=1S/C12H15N3/c1-13-12-9-11(14(2)15(12)3)10-7-5-4-6-8-10/h4-9H,1-3H3/b13-12+ |
| InChIKey | AOSNOFXFNJCQTE-OUKQBFOZSA-N |
| XLogP | 1.56 |
| TPSA | 22.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |