C11H12FN2+ — CID 57189950
2-(4-fluorophenyl)-1,1-dimethylimidazol-1-ium (PubChem CID 57189950) has the molecular formula C11H12FN2+ and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,1-dimethylimidazol-1-ium.
| Compound Name | 2-(4-fluorophenyl)-1,1-dimethylimidazol-1-ium |
|---|---|
| PubChem CID | 57189950 |
| Molecular Formula | C11H12FN2+ |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | 2-(4-fluorophenyl)-1,1-dimethylimidazol-1-ium |
| SMILES | C[N+]1(C)C=CN=C1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FN2/c1-14(2)8-7-13-11(14)9-3-5-10(12)6-4-9/h3-8H,1-2H3/q+1 |
| InChIKey | JAGCUNMOJGVACT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|