C15H19FN4 — CID 123153052
(2E)-4-[(4-fluorophenyl)methyl-(methylideneamino)amino]-N',3-dimethylpenta-2,4-dienimidamide (PubChem CID 123153052) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is (2E)-4-[(4-fluorophenyl)methyl-(methylideneamino)amino]-N',3-dimethylpenta-2,4-dienimidamide.
| Compound Name | (2E)-4-[(4-fluorophenyl)methyl-(methylideneamino)amino]-N',3-dimethylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 123153052 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (2E)-4-[(4-fluorophenyl)methyl-(methylideneamino)amino]-N',3-dimethylpenta-2,4-dienimidamide |
| SMILES | C=NN(Cc1ccc(F)cc1)C(=C)/C(C)=C/C(N)=N/C |
| InChI | InChI=1S/C15H19FN4/c1-11(9-15(17)18-3)12(2)20(19-4)10-13-5-7-14(16)8-6-13/h5-9H,2,4,10H2,1,3H3,(H2,17,18)/b11-9+ |
| InChIKey | BDGVZWVTRNIARH-PKNBQFBNSA-N |
| XLogP | 2.69 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|