C21H17N3 — CID 58880603
6-isocyano-3-methyl-2-(4-methylphenyl)-7-phenyl-1H-pyrrolo[1,2-a]imidazole (PubChem CID 58880603) has the molecular formula C21H17N3 and a molecular weight of 311.39 g/mol. Its IUPAC name is 6-isocyano-3-methyl-2-(4-methylphenyl)-7-phenyl-1H-pyrrolo[1,2-a]imidazole.
| Compound Name | 6-isocyano-3-methyl-2-(4-methylphenyl)-7-phenyl-1H-pyrrolo[1,2-a]imidazole |
|---|---|
| PubChem CID | 58880603 |
| Molecular Formula | C21H17N3 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 6-isocyano-3-methyl-2-(4-methylphenyl)-7-phenyl-1H-pyrrolo[1,2-a]imidazole |
| SMILES | [C-]#[N+]c1cn2c(C)c(-c3ccc(C)cc3)[nH]c2c1-c1ccccc1 |
| InChI | InChI=1S/C21H17N3/c1-14-9-11-17(12-10-14)20-15(2)24-13-18(22-3)19(21(24)23-20)16-7-5-4-6-8-16/h4-13,23H,1-2H3 |
| InChIKey | NJDTVJNSQJBZIK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|