C22H19N3O — CID 20578655
2-(4-ethoxyphenyl)-6-isocyano-3-methyl-7-phenyl-1H-pyrrolo[1,2-a]imidazole (PubChem CID 20578655) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-6-isocyano-3-methyl-7-phenyl-1H-pyrrolo[1,2-a]imidazole.
| Compound Name | 2-(4-ethoxyphenyl)-6-isocyano-3-methyl-7-phenyl-1H-pyrrolo[1,2-a]imidazole |
|---|---|
| PubChem CID | 20578655 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-(4-ethoxyphenyl)-6-isocyano-3-methyl-7-phenyl-1H-pyrrolo[1,2-a]imidazole |
| SMILES | [C-]#[N+]c1cn2c(C)c(-c3ccc(OCC)cc3)[nH]c2c1-c1ccccc1 |
| InChI | InChI=1S/C22H19N3O/c1-4-26-18-12-10-17(11-13-18)21-15(2)25-14-19(23-3)20(22(25)24-21)16-8-6-5-7-9-16/h5-14,24H,4H2,1-2H3 |
| InChIKey | UWGWNFKPTWAPEE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 33.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|