C26H21N3OS — CID 23765467
2-(4-ethoxyphenyl)-8-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione (PubChem CID 23765467) has the molecular formula C26H21N3OS and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-8-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione.
| Compound Name | 2-(4-ethoxyphenyl)-8-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
|---|---|
| PubChem CID | 23765467 |
| Molecular Formula | C26H21N3OS |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-(4-ethoxyphenyl)-8-(4-phenylphenyl)-1H-imidazo[1,2-c]pyrimidine-5-thione |
| SMILES | CCOc1ccc(-c2cn3c(=S)ncc(-c4ccc(-c5ccccc5)cc4)c3[nH]2)cc1 |
| InChI | InChI=1S/C26H21N3OS/c1-2-30-22-14-12-21(13-15-22)24-17-29-25(28-24)23(16-27-26(29)31)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h3-17,28H,2H2,1H3 |
| InChIKey | VXEIJMZVEIRKLD-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 42.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|